* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL095213 |
| English Synonyms: | SYNTHON-LAB SL095213 |
| MDL Number.: | MFCD04330754 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1ccccc1/N=C/2\C(=N\c3ccccc3C)\N(C(=S)N2Cc4ccccc4)/N=C/c5ccc(cc5)Br |
| InChi: | InChI=1S/C31H26BrN5S/c1-22-10-6-8-14-27(22)34-29-30(35-28-15-9-7-11-23(28)2)37(33-20-24-16-18-26(32)19-17-24)31(38)36(29)21-25-12-4-3-5-13-25/h3-20H,21H2,1-2H3/b33-20+,34-29+,35-30- |
| InChiKey: | InChIKey=SYFZXMQVJMZCTN-FRPWGPETSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.