* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL075839 |
| English Synonyms: | SYNTHON-LAB SL075839 |
| MDL Number.: | MFCD04333660 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)C(c1nnc(n1CC=C)SCC(=O)Nc2c(cc(cc2Br)F)F)NC(=O)c3ccccc3 |
| InChi: | InChI=1S/C24H24BrF2N5O2S/c1-4-10-32-22(20(14(2)3)29-23(34)15-8-6-5-7-9-15)30-31-24(32)35-13-19(33)28-21-17(25)11-16(26)12-18(21)27/h4-9,11-12,14,20H,1,10,13H2,2-3H3,(H,28,33)(H,29,34) |
| InChiKey: | InChIKey=WHRYNVLHLWOXCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.