* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL080591 |
| English Synonyms: | SYNTHON-LAB SL080591 |
| MDL Number.: | MFCD04335837 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | Cc1c(c([nH]n1)O)C(c2cn(nc2c3cccs3)c4ccccc4)c5c(n[nH]c5O)C |
| InChi: | InChI=1S/C22H20N6O2S/c1-12-17(21(29)25-23-12)19(18-13(2)24-26-22(18)30)15-11-28(14-7-4-3-5-8-14)27-20(15)16-9-6-10-31-16/h3-11,19H,1-2H3,(H2,23,25,29)(H2,24,26,30) |
| InChiKey: | InChIKey=LXNXRBUYEMYSEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.