* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053420 |
| English Synonyms: | SYNTHON-LAB SL053420 |
| MDL Number.: | MFCD04353631 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COc1cccc(c1)CNC(=O)C(=O)NCC2CCCO2 |
| InChi: | InChI=1S/C15H20N2O4/c1-20-12-5-2-4-11(8-12)9-16-14(18)15(19)17-10-13-6-3-7-21-13/h2,4-5,8,13H,3,6-7,9-10H2,1H3,(H,16,18)(H,17,19) |
| InChiKey: | InChIKey=XQNCNOXGIYLKCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.