* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL052378 |
| English Synonyms: | SYNTHON-LAB SL052378 |
| MDL Number.: | MFCD04354487 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCN1CCCC1CNC(=O)C(=O)Nc2cccc(c2)C(F)(F)F |
| InChi: | InChI=1S/C16H20F3N3O2/c1-2-22-8-4-7-13(22)10-20-14(23)15(24)21-12-6-3-5-11(9-12)16(17,18)19/h3,5-6,9,13H,2,4,7-8,10H2,1H3,(H,20,23)(H,21,24) |
| InChiKey: | InChIKey=NUFGNVDRZVVPJP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.