* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL039151 |
| English Synonyms: | SYNTHON-LAB SL039151 |
| MDL Number.: | MFCD04354846 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCc1ccccc1NC(=O)CN2C(=O)/C(=C\c3cc(n(c3C)c4ccccn4)C)/NC2=O |
| InChi: | InChI=1S/C25H25N5O3/c1-4-18-9-5-6-10-20(18)27-23(31)15-29-24(32)21(28-25(29)33)14-19-13-16(2)30(17(19)3)22-11-7-8-12-26-22/h5-14H,4,15H2,1-3H3,(H,27,31)(H,28,33)/b21-14+ |
| InChiKey: | InChIKey=YUEURJUJGVXLJD-KGENOOAVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.