* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036292 |
| English Synonyms: | SYNTHON-LAB SL036292 |
| MDL Number.: | MFCD04355858 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CCOc1cc(c(cc1OCC(=O)Nc2ccccc2)Br)/C=C(\C#N)/C(=O)NCCc3c[nH]c4c3cccc4 |
| InChi: | InChI=1S/C30H27BrN4O4/c1-2-38-27-15-21(25(31)16-28(27)39-19-29(36)35-23-8-4-3-5-9-23)14-22(17-32)30(37)33-13-12-20-18-34-26-11-7-6-10-24(20)26/h3-11,14-16,18,34H,2,12-13,19H2,1H3,(H,33,37)(H,35,36)/b22-14+ |
| InChiKey: | InChIKey=WKQWCNIRHSTGDS-HYARGMPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.