* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL038500 |
| English Synonyms: | SYNTHON-LAB SL038500 |
| MDL Number.: | MFCD04356279 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | COc1cc(ccc1/C=C/2\C(=O)N(C(=O)S2)Cc3ccc(cc3)Cl)N4CCCC4 |
| InChi: | InChI=1S/C22H21ClN2O3S/c1-28-19-13-18(24-10-2-3-11-24)9-6-16(19)12-20-21(26)25(22(27)29-20)14-15-4-7-17(23)8-5-15/h4-9,12-13H,2-3,10-11,14H2,1H3/b20-12+ |
| InChiKey: | InChIKey=ODBXEIKQHOKBIU-UDWIEESQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.