* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053973 |
| English Synonyms: | SYNTHON-LAB SL053973 |
| MDL Number.: | MFCD04357229 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CCC(CO)NC(=O)C(=O)Nc1ccc(cc1)OCC |
| InChi: | InChI=1S/C14H20N2O4/c1-3-10(9-17)15-13(18)14(19)16-11-5-7-12(8-6-11)20-4-2/h5-8,10,17H,3-4,9H2,1-2H3,(H,15,18)(H,16,19) |
| InChiKey: | InChIKey=HLYPIELJBBZPGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.