* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL051815 |
| English Synonyms: | SYNTHON-LAB SL051815 |
| MDL Number.: | MFCD04357530 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COc1cc(ccc1OCC(=O)NCc2ccccc2)C(=S)N3CCCC3 |
| InChi: | InChI=1S/C21H24N2O3S/c1-25-19-13-17(21(27)23-11-5-6-12-23)9-10-18(19)26-15-20(24)22-14-16-7-3-2-4-8-16/h2-4,7-10,13H,5-6,11-12,14-15H2,1H3,(H,22,24) |
| InChiKey: | InChIKey=HLFWGMMJOMTMSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.