* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036840 |
| English Synonyms: | SYNTHON-LAB SL036840 |
| MDL Number.: | MFCD04357705 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(c1)nc([nH]2)/C(=C\c3ccc(cc3C)N4CCCC4)/C#N |
| InChi: | InChI=1S/C22H22N4/c1-15-5-8-20-21(11-15)25-22(24-20)18(14-23)13-17-6-7-19(12-16(17)2)26-9-3-4-10-26/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,24,25)/b18-13- |
| InChiKey: | InChIKey=SPIXVNQLIJRBCL-AQTBWJFISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.