* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036879 |
| English Synonyms: | SYNTHON-LAB SL036879 |
| MDL Number.: | MFCD04357828 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOc1cc(cc(c1OCC#C)CC=C)/C=C(\C#N)/C(=O)Nc2cccc(c2)OC |
| InChi: | InChI=1S/C25H24N2O4/c1-5-9-19-13-18(15-23(30-7-3)24(19)31-12-6-2)14-20(17-26)25(28)27-21-10-8-11-22(16-21)29-4/h2,5,8,10-11,13-16H,1,7,9,12H2,3-4H3,(H,27,28)/b20-14+ |
| InChiKey: | InChIKey=BCSVWEKSPBRVKZ-XSFVSMFZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.