* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL049766 |
| English Synonyms: | SYNTHON-LAB SL049766 |
| MDL Number.: | MFCD04358199 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CN(C)CCNC(=O)C(=O)NCCOC |
| InChi: | InChI=1S/C9H19N3O3/c1-12(2)6-4-10-8(13)9(14)11-5-7-15-3/h4-7H2,1-3H3,(H,10,13)(H,11,14) |
| InChiKey: | InChIKey=SQAZEUNBBZQRFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.