* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036435 |
| English Synonyms: | SYNTHON-LAB SL036435 |
| MDL Number.: | MFCD04358634 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c(cn2CC(=O)Nc3ccc(cc3)F)/C=N/NC(=O)COc4cccc5c4nccc5 |
| InChi: | InChI=1S/C28H22FN5O3/c29-21-10-12-22(13-11-21)32-26(35)17-34-16-20(23-7-1-2-8-24(23)34)15-31-33-27(36)18-37-25-9-3-5-19-6-4-14-30-28(19)25/h1-16H,17-18H2,(H,32,35)(H,33,36)/b31-15+ |
| InChiKey: | InChIKey=MPOXGZHWMQJEGY-IBBHUPRXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.