* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037060 |
| English Synonyms: | SYNTHON-LAB SL037060 |
| MDL Number.: | MFCD04373917 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(n1c2ccc(cc2)C(=O)N/N=C/c3ccc(cc3)C#N)c4ccccc4 |
| InChi: | InChI=1S/C26H20N4O/c1-19-7-16-25(22-5-3-2-4-6-22)30(19)24-14-12-23(13-15-24)26(31)29-28-18-21-10-8-20(17-27)9-11-21/h2-16,18H,1H3,(H,29,31)/b28-18+ |
| InChiKey: | InChIKey=DYXAGKSCEAACGH-MTDXEUNCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.