* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL055383 |
| English Synonyms: | SYNTHON-LAB SL055383 |
| MDL Number.: | MFCD04373955 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCN1CCCC1CNC(=O)C(=O)Nc2c(cccc2C)C |
| InChi: | InChI=1S/C17H25N3O2/c1-4-20-10-6-9-14(20)11-18-16(21)17(22)19-15-12(2)7-5-8-13(15)3/h5,7-8,14H,4,6,9-11H2,1-3H3,(H,18,21)(H,19,22) |
| InChiKey: | InChIKey=RPBOVOYMQOTGDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.