* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL075982 |
| English Synonyms: | SYNTHON-LAB SL075982 |
| MDL Number.: | MFCD04380249 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCn1c(nnc1SCC(=O)NC(C)c2ccccc2)CC(=O)Nc3ccc(cc3)C |
| InChi: | InChI=1S/C23H27N5O2S/c1-4-28-20(14-21(29)25-19-12-10-16(2)11-13-19)26-27-23(28)31-15-22(30)24-17(3)18-8-6-5-7-9-18/h5-13,17H,4,14-15H2,1-3H3,(H,24,30)(H,25,29) |
| InChiKey: | InChIKey=YYWRSFSMGWPOAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.