* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL085748 |
| English Synonyms: | SYNTHON-LAB SL085748 |
| MDL Number.: | MFCD04380634 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)Cc2nnc(n2CC=C)SCC(=O)Nc3cc(c(cc3Cl)Cl)Cl |
| InChi: | InChI=1S/C21H19Cl3N4O2S/c1-3-8-28-19(9-13-4-6-14(30-2)7-5-13)26-27-21(28)31-12-20(29)25-18-11-16(23)15(22)10-17(18)24/h3-7,10-11H,1,8-9,12H2,2H3,(H,25,29) |
| InChiKey: | InChIKey=UQEIXLBDGZULQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.