* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL084346 |
| English Synonyms: | SYNTHON-LAB SL084346 |
| MDL Number.: | MFCD04383073 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)n2c(nnc2SCC(=O)N3CCN(CC3)c4ccccc4)CNC(=O)c5ccccc5F |
| InChi: | InChI=1S/C28H27FN6O2S/c29-24-14-8-7-13-23(24)27(37)30-19-25-31-32-28(35(25)22-11-5-2-6-12-22)38-20-26(36)34-17-15-33(16-18-34)21-9-3-1-4-10-21/h1-14H,15-20H2,(H,30,37) |
| InChiKey: | InChIKey=VIRIQCGTUXMMEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.