* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL075955 |
| English Synonyms: | SYNTHON-LAB SL075955 |
| MDL Number.: | MFCD04383893 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1c(nc(s1)NC(=O)CSc2nnc(n2CC=C)C(C(C)C)NC(=O)c3ccccc3)c4ccccc4 |
| InChi: | InChI=1S/C28H30N6O2S2/c1-5-16-34-25(23(18(2)3)30-26(36)21-14-10-7-11-15-21)32-33-28(34)37-17-22(35)29-27-31-24(19(4)38-27)20-12-8-6-9-13-20/h5-15,18,23H,1,16-17H2,2-4H3,(H,30,36)(H,29,31,35) |
| InChiKey: | InChIKey=XKNBWZPORBCEHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.