* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL075969 |
| English Synonyms: | SYNTHON-LAB SL075969 |
| MDL Number.: | MFCD04385773 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCn1c(nnc1SCC(=O)NC2CCCCC2)CC(=O)Nc3ccc(cc3)C |
| InChi: | InChI=1S/C21H29N5O2S/c1-3-26-18(13-19(27)22-17-11-9-15(2)10-12-17)24-25-21(26)29-14-20(28)23-16-7-5-4-6-8-16/h9-12,16H,3-8,13-14H2,1-2H3,(H,22,27)(H,23,28) |
| InChiKey: | InChIKey=XHYGYBCZROGMDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.