* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034000 |
English Synonyms: | SYNTHON-LAB SL034000 |
MDL Number.: | MFCD04475939 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCOc1ccc(cc1)/N=C\2/NC(=O)/C(=C\c3ccc(c(c3)OC)OCC(=O)O)/S2 |
InChi: | InChI=1S/C21H20N2O6S/c1-3-28-15-7-5-14(6-8-15)22-21-23-20(26)18(30-21)11-13-4-9-16(17(10-13)27-2)29-12-19(24)25/h4-11H,3,12H2,1-2H3,(H,24,25)(H,22,23,26)/b18-11+ |
InChiKey: | InChIKey=MQTBSOYLTZGNHX-WOJGMQOQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.