* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034073 |
English Synonyms: | SYNTHON-LAB SL034073 |
MDL Number.: | MFCD04476267 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CCOCCN\1C(=O)/C(=C\c2cc(c(c(c2)Cl)OCc3ccccc3C#N)OC)/S/C1=N\c4ccccc4 |
InChi: | InChI=1S/C29H26ClN3O4S/c1-3-36-14-13-33-28(34)26(38-29(33)32-23-11-5-4-6-12-23)17-20-15-24(30)27(25(16-20)35-2)37-19-22-10-8-7-9-21(22)18-31/h4-12,15-17H,3,13-14,19H2,1-2H3/b26-17+,32-29- |
InChiKey: | InChIKey=FBUYQJZQRLFOEQ-PIVAAZNYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.