* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL093273 |
| English Synonyms: | SYNTHON-LAB SL093273 |
| MDL Number.: | MFCD04477354 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(cc(c1)NC(=S)NC(=O)c2ccc(cc2)Cl)C(F)(F)F |
| InChi: | InChI=1S/C15H10ClF3N2OS/c16-11-6-4-9(5-7-11)13(22)21-14(23)20-12-3-1-2-10(8-12)15(17,18)19/h1-8H,(H2,20,21,22,23) |
| InChiKey: | InChIKey=CVCRFWIXELNVOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.