* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL022923 |
| English Synonyms: | SYNTHON-LAB SL022923 |
| MDL Number.: | MFCD04479777 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(cc1/C=C\3/C(=O)N(C(=O)N3)Cc4ccc(c(c4)Cl)Cl)OCO2 |
| InChi: | InChI=1S/C19H14Cl2N2O5/c1-26-15-7-17-16(27-9-28-17)6-11(15)5-14-18(24)23(19(25)22-14)8-10-2-3-12(20)13(21)4-10/h2-7H,8-9H2,1H3,(H,22,25)/b14-5- |
| InChiKey: | InChIKey=OPEAVDCNPJAAMD-RZNTYIFUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.