* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033073 |
English Synonyms: | SYNTHON-LAB SL033073 |
MDL Number.: | MFCD04479906 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CN2C(=O)/C(=C\c3cc(cs3)Br)/NC2=O)Br |
InChi: | InChI=1S/C15H10Br2N2O2S/c16-10-3-1-9(2-4-10)7-19-14(20)13(18-15(19)21)6-12-5-11(17)8-22-12/h1-6,8H,7H2,(H,18,21)/b13-6+ |
InChiKey: | InChIKey=QKOQEJVAWWSPSI-AWNIVKPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.