* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035293 |
English Synonyms: | SYNTHON-LAB SL035293 |
MDL Number.: | MFCD04481174 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | COc1ccc(c(c1)OC)N2C(=O)/C(=C\c3cccn3c4ccc(cc4)C(=O)O)/C(=O)NC2=S |
InChi: | InChI=1S/C24H19N3O6S/c1-32-17-9-10-19(20(13-17)33-2)27-22(29)18(21(28)25-24(27)34)12-16-4-3-11-26(16)15-7-5-14(6-8-15)23(30)31/h3-13H,1-2H3,(H,30,31)(H,25,28,34)/b18-12- |
InChiKey: | InChIKey=DTQUORJDXAONIE-PDGQHHTCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.