* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034098 |
| English Synonyms: | SYNTHON-LAB SL034098 |
| MDL Number.: | MFCD04482225 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1c(cccc1Cl)/N=C\2/NC(=O)/C(=C\c3ccc(o3)N4CCCC4)/S2 |
| InChi: | InChI=1S/C19H18ClN3O2S/c1-12-14(20)5-4-6-15(12)21-19-22-18(24)16(26-19)11-13-7-8-17(25-13)23-9-2-3-10-23/h4-8,11H,2-3,9-10H2,1H3,(H,21,22,24)/b16-11+ |
| InChiKey: | InChIKey=MHNSWYVHSXPRAK-LFIBNONCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.