* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL033284 |
| English Synonyms: | SYNTHON-LAB SL033284 |
| MDL Number.: | MFCD04493645 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCN1C(=O)/C(=C\c2ccc(o2)N3CCOCC3)/SC1=O |
| InChi: | InChI=1S/C14H16N2O4S/c1-2-16-13(17)11(21-14(16)18)9-10-3-4-12(20-10)15-5-7-19-8-6-15/h3-4,9H,2,5-8H2,1H3/b11-9+ |
| InChiKey: | InChIKey=LULFIOSMQCIMHL-PKNBQFBNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.