* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL029615 |
English Synonyms: | SYNTHON-LAB SL029615 |
MDL Number.: | MFCD04500018 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CN1C(=O)/C(=C/c2ccc(c(c2)[N+](=O)[O-])O)/C(=O)NC1=S |
InChi: | InChI=1S/C12H9N3O5S/c1-14-11(18)7(10(17)13-12(14)21)4-6-2-3-9(16)8(5-6)15(19)20/h2-5,16H,1H3,(H,13,17,21)/b7-4+ |
InChiKey: | InChIKey=YXROEPPVLIAPEE-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.