* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL029380 |
| English Synonyms: | SYNTHON-LAB SL029380 |
| MDL Number.: | MFCD04500493 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C/C=C\1/C(=O)N/C(=N/c2cccc(c2C)Cl)/S1.c1ccc(c(c1)O)I |
| InChi: | InChI=1S/C12H11ClN2OS.C6H5IO/c1-3-10-11(16)15-12(17-10)14-9-6-4-5-8(13)7(9)2;7-5-3-1-2-4-6(5)8/h3-6H,1-2H3,(H,14,15,16);1-4,8H/b10-3-; |
| InChiKey: | InChIKey=PEPSHRIEYCKLGR-HVHUWTQGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.