* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031075 |
English Synonyms: | SYNTHON-LAB SL031075 |
MDL Number.: | MFCD04501046 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)OC(=O)COc1ccc(cc1)/C=N/Nc2ccc(cc2)[N+](=O)[O-] |
InChi: | InChI=1S/C18H19N3O5/c1-13(2)26-18(22)12-25-17-9-3-14(4-10-17)11-19-20-15-5-7-16(8-6-15)21(23)24/h3-11,13,20H,12H2,1-2H3/b19-11+ |
InChiKey: | InChIKey=GMDQTOBGBOVGSZ-YBFXNURJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.