* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033130 |
English Synonyms: | SYNTHON-LAB SL033130 |
MDL Number.: | MFCD04501169 |
H bond acceptor: | 10 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)NC(=O)CN2C(=O)/C(=C\c3ccc(c(c3)[N+](=O)[O-])O)/NC2=O |
InChi: | InChI=1S/C18H14N4O6/c23-15-7-6-11(9-14(15)22(27)28)8-13-17(25)21(18(26)20-13)10-16(24)19-12-4-2-1-3-5-12/h1-9,23H,10H2,(H,19,24)(H,20,26)/b13-8+ |
InChiKey: | InChIKey=FHGQHWFKHPMKAO-MDWZMJQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.