* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL053222 |
English Synonyms: | SYNTHON-LAB SL053222 |
MDL Number.: | MFCD04501241 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | Cc1ccccc1NC(=O)C(=O)N/N=C/c2ccccc2OCC(=O)Nc3cc(ccc3C)Cl |
InChi: | InChI=1S/C25H23ClN4O4/c1-16-7-3-5-9-20(16)29-24(32)25(33)30-27-14-18-8-4-6-10-22(18)34-15-23(31)28-21-13-19(26)12-11-17(21)2/h3-14H,15H2,1-2H3,(H,28,31)(H,29,32)(H,30,33)/b27-14+ |
InChiKey: | InChIKey=BNCGUXAGFTWHNK-MZJWZYIUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.