* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031559 |
| English Synonyms: | SYNTHON-LAB SL031559 |
| MDL Number.: | MFCD04502681 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CN(C)c1ccc(cc1)/C=C/C=C\2/C(=O)NC(=O)N(C2=O)c3ccc(cc3)Br |
| InChi: | InChI=1S/C21H18BrN3O3/c1-24(2)16-10-6-14(7-11-16)4-3-5-18-19(26)23-21(28)25(20(18)27)17-12-8-15(22)9-13-17/h3-13H,1-2H3,(H,23,26,28)/b4-3+,18-5- |
| InChiKey: | InChIKey=KPHRPHTVZBUTSU-ONCSWLTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.