* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034794 |
| English Synonyms: | SYNTHON-LAB SL034794 |
| MDL Number.: | MFCD04503589 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)NC(=S)N/N=C/c2cccn2c3cccc(c3)C(=O)O |
| InChi: | InChI=1S/C19H16N4O2S/c24-18(25)14-6-4-9-16(12-14)23-11-5-10-17(23)13-20-22-19(26)21-15-7-2-1-3-8-15/h1-13H,(H,24,25)(H2,21,22,26)/b20-13+ |
| InChiKey: | InChIKey=YONDZRQJIZPKNI-DEDYPNTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.