* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031497 |
English Synonyms: | SYNTHON-LAB SL031497 |
MDL Number.: | MFCD04505221 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1/C=N\NC(=O)COc2ccc(cc2Cl)Cl)OCc3ccc(cc3Br)Br |
InChi: | InChI=1S/C22H16Br2Cl2N2O3/c23-16-4-3-15(19(24)9-16)12-30-18-6-1-14(2-7-18)11-27-28-22(29)13-31-21-8-5-17(25)10-20(21)26/h1-11H,12-13H2,(H,28,29)/b27-11- |
InChiKey: | InChIKey=JCTBXJIVNSUPGI-BCHBDCPOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.