* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL052508 |
| English Synonyms: | SYNTHON-LAB SL052508 |
| MDL Number.: | MFCD04505451 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)NC(=O)COc2cccc(c2)C=C3C(=O)c4ccccc4C3=O |
| InChi: | InChI=1S/C25H19NO4/c1-16-9-11-18(12-10-16)26-23(27)15-30-19-6-4-5-17(13-19)14-22-24(28)20-7-2-3-8-21(20)25(22)29/h2-14H,15H2,1H3,(H,26,27) |
| InChiKey: | InChIKey=FUADWDMVCSEVRR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.