* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053205 |
| English Synonyms: | SYNTHON-LAB SL053205 |
| MDL Number.: | MFCD04506727 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | CCOc1cc(ccc1OCC(=O)Nc2ccccc2)/C=N/NC(=O)C(=O)Nc3ccccc3Cl |
| InChi: | InChI=1S/C25H23ClN4O5/c1-2-34-22-14-17(12-13-21(22)35-16-23(31)28-18-8-4-3-5-9-18)15-27-30-25(33)24(32)29-20-11-7-6-10-19(20)26/h3-15H,2,16H2,1H3,(H,28,31)(H,29,32)(H,30,33)/b27-15+ |
| InChiKey: | InChIKey=QLUXCJVYOSKBST-JFLMPSFJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.