* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL035286 |
| English Synonyms: | SYNTHON-LAB SL035286 |
| MDL Number.: | MFCD04513982 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCc1ccccc1N2C(=O)/C(=C\c3cccn3C(C)(C)C)/C(=O)NC2=S |
| InChi: | InChI=1S/C21H23N3O2S/c1-5-14-9-6-7-11-17(14)24-19(26)16(18(25)22-20(24)27)13-15-10-8-12-23(15)21(2,3)4/h6-13H,5H2,1-4H3,(H,22,25,27)/b16-13- |
| InChiKey: | InChIKey=FMLLHBOZGJQOGE-SSZFMOIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.