* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL094434 |
English Synonyms: | SYNTHON-LAB SL094434 |
MDL Number.: | MFCD04524492 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1)COc2ccc(cc2)/C=C\3/C(=O)N=C(S3)N4CCN(CC4)C |
InChi: | InChI=1S/C23H25N3O2S/c1-17-3-5-19(6-4-17)16-28-20-9-7-18(8-10-20)15-21-22(27)24-23(29-21)26-13-11-25(2)12-14-26/h3-10,15H,11-14,16H2,1-2H3/b21-15- |
InChiKey: | InChIKey=SWJVYXQYLXIWLC-QNGOZBTKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.