* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL029876 |
English Synonyms: | SYNTHON-LAB SL029876 |
MDL Number.: | MFCD04524861 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1cc(ccc1OCC#C)/C=C/2\C(=O)NC(=S)N(C2=O)CC=C |
InChi: | InChI=1S/C18H16N2O4S/c1-4-8-20-17(22)13(16(21)19-18(20)25)10-12-6-7-14(24-9-5-2)15(11-12)23-3/h2,4,6-7,10-11H,1,8-9H2,3H3,(H,19,21,25)/b13-10+ |
InChiKey: | InChIKey=MOAPGPVBNHUVDP-JLHYYAGUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.