* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031489 |
English Synonyms: | SYNTHON-LAB SL031489 |
MDL Number.: | MFCD04525552 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | COc1cc(ccc1OCc2cccc(c2)C(=O)O)/C=N\NC(=O)CSc3ccc(cc3)[N+](=O)[O-] |
InChi: | InChI=1S/C24H21N3O7S/c1-33-22-12-16(5-10-21(22)34-14-17-3-2-4-18(11-17)24(29)30)13-25-26-23(28)15-35-20-8-6-19(7-9-20)27(31)32/h2-13H,14-15H2,1H3,(H,26,28)(H,29,30)/b25-13- |
InChiKey: | InChIKey=IIWKMJVVZIXPJT-MXAYSNPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.