* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035170 |
English Synonyms: | SYNTHON-LAB SL035170 |
MDL Number.: | MFCD04525773 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CN2C(=O)/C(=C\c3ccc(c(c3)F)N4CCCC4)/NC2=O)[N+](=O)[O-] |
InChi: | InChI=1S/C21H19FN4O4/c22-17-11-15(5-8-19(17)24-9-1-2-10-24)12-18-20(27)25(21(28)23-18)13-14-3-6-16(7-4-14)26(29)30/h3-8,11-12H,1-2,9-10,13H2,(H,23,28)/b18-12+ |
InChiKey: | InChIKey=LWGUNNGWAWCPTO-LDADJPATSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.