* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL031267 |
English Synonyms: | SYNTHON-LAB SL031267 |
MDL Number.: | MFCD04526844 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1cc(cc(c1OCc2ccc(cc2Cl)Cl)CC=C)/C=C/3\C(=O)NC(=S)N(C3=O)c4ccc(cc4)F |
InChi: | InChI=1S/C28H21Cl2FN2O4S/c1-3-4-17-11-16(13-24(36-2)25(17)37-15-18-5-6-19(29)14-23(18)30)12-22-26(34)32-28(38)33(27(22)35)21-9-7-20(31)8-10-21/h3,5-14H,1,4,15H2,2H3,(H,32,34,38)/b22-12+ |
InChiKey: | InChIKey=AZCKAXLTSWFKAM-WSDLNYQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.