* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL027098 |
| English Synonyms: | SYNTHON-LAB SL027098 |
| MDL Number.: | MFCD04526911 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCOc1ccc(cc1)N2C(=O)/C(=C\c3cc(c(c(c3)OCC)O)CC=C)/C(=O)NC2=S |
| InChi: | InChI=1S/C24H24N2O5S/c1-4-7-16-12-15(14-20(21(16)27)31-6-3)13-19-22(28)25-24(32)26(23(19)29)17-8-10-18(11-9-17)30-5-2/h4,8-14,27H,1,5-7H2,2-3H3,(H,25,28,32)/b19-13- |
| InChiKey: | InChIKey=MOANIIHPXWYOQI-UYRXBGFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.