* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL082967 |
| English Synonyms: | SYNTHON-LAB SL082967 |
| MDL Number.: | MFCD04527036 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)n2cc(c(n2)c3cccs3)/C=C(/C#N)\c4ccc(cc4)[N+](=O)[O-] |
| InChi: | InChI=1S/C22H14N4O2S/c23-14-17(16-8-10-20(11-9-16)26(27)28)13-18-15-25(19-5-2-1-3-6-19)24-22(18)21-7-4-12-29-21/h1-13,15H/b17-13- |
| InChiKey: | InChIKey=DFPRDXFPYGOTCM-LGMDPLHJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.