* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031912 |
| English Synonyms: | SYNTHON-LAB SL031912 |
| MDL Number.: | MFCD04527452 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1N2C(=O)/C(=C\c3c[nH]c4c3cc(cc4)Br)/C(=O)NC2=O)Br |
| InChi: | InChI=1S/C19H11Br2N3O3/c20-11-1-4-13(5-2-11)24-18(26)15(17(25)23-19(24)27)7-10-9-22-16-6-3-12(21)8-14(10)16/h1-9,22H,(H,23,25,27)/b15-7- |
| InChiKey: | InChIKey=WPNHESRXICFHMB-CHHVJCJISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.