* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL035155 |
| English Synonyms: | SYNTHON-LAB SL035155 |
| MDL Number.: | MFCD04528509 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1/C=C/2\C(=O)N(C(=O)N2)CC(=O)Nc3ccc(cc3)Cl)N4CCOCC4 |
| InChi: | InChI=1S/C22H21ClN4O4/c23-16-3-5-17(6-4-16)24-20(28)14-27-21(29)19(25-22(27)30)13-15-1-7-18(8-2-15)26-9-11-31-12-10-26/h1-8,13H,9-12,14H2,(H,24,28)(H,25,30)/b19-13+ |
| InChiKey: | InChIKey=RDKUZEYMUMAUFE-CPNJWEJPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.