* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL030863 |
| English Synonyms: | SYNTHON-LAB SL030863 |
| MDL Number.: | MFCD04529141 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COc1ccc(c(c1OC)OC)/C=C\2/C(=O)NC(=O)N2 |
| InChi: | InChI=1S/C13H14N2O5/c1-18-9-5-4-7(10(19-2)11(9)20-3)6-8-12(16)15-13(17)14-8/h4-6H,1-3H3,(H2,14,15,16,17)/b8-6- |
| InChiKey: | InChIKey=KTIAAWKWAONQGB-VURMDHGXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.